cas: 164918-61-0 — see every product listed under this CAS number, including other names
Sodium 3-bromo-2,4,6-trioxo-1,3,5-triazinan-1-ide 85% (CAS 164918-61-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A406812-25g |
| cas | 164918-61-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 1827.75 Pln | |
| Ambeed | 100g | 5704.81 Pln |
| purity | 85% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A406812 |
Sodium 6-bromo-1,3-diaza-5-azanidacyclohexane-2,4-dione (CAS 164918-61-0) is a chemical compound with the molecular formula C3H3BrN3NaO2 and a molecular weight of 215.97 g/mol. IUPAC name: sodium 6-bromo-1,3-diaza-5-azanidacyclohexane-2,4-dione. InChIKey: NZQDCCVEWNITLV-UHFFFAOYSA-M.
| Molecular formula | C3H3BrN3NaO2 |
|---|---|
| Molecular weight | 215.97 g/mol |
| IUPAC name | sodium 6-bromo-1,3-diaza-5-azanidacyclohexane-2,4-dione |
| InChIKey | NZQDCCVEWNITLV-UHFFFAOYSA-M |
| SMILES | C1(NC(=O)NC(=O)[N-]1)Br.[Na+] |
Computed by PubChem (NCBI)