Sodium 5,6,7,8-tetrahydronaphthalene-2-sulfinate, 95%
cas: 1504174-30-4 — see every product listed under this CAS number, including other names
Sodium 5,6,7,8-tetrahydronaphthalene-2-sulfinate, 95% (CAS 1504174-30-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1125798-100mg |
| cas | 1504174-30-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 943.31 Pln | |
| Ambeed | 1g | 2422.94 Pln | |
| Ambeed | 5g | 9476.19 Pln | |
| BLDpharm | 100mg | 653.13 Pln | |
| BLDpharm | 250mg | 1014.11 Pln | |
| BLDpharm | 1g | 2608.00 Pln | |
| BLDpharm | 5g | 10216.43 Pln | |
| Chemat | 100mg | 674.00 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2834.00 Pln | |
| Fluorochem | 100mg | 1242.29 Pln | |
| Fluorochem | 250mg | 2028.47 Pln | |
| Fluorochem | 1g | 5256.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Sodium 5,6,7,8-tetrahydronaphthalene-2-sulfinate (CAS 1504174-30-4) is a chemical compound with the molecular formula C10H11NaO2S and a molecular weight of 218.25 g/mol. IUPAC name: sodium 5,6,7,8-tetrahydronaphthalene-2-sulfinate. InChIKey: CQWCRHZFLKXWAV-UHFFFAOYSA-M.
| Molecular formula | C10H11NaO2S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | sodium 5,6,7,8-tetrahydronaphthalene-2-sulfinate |
| InChIKey | CQWCRHZFLKXWAV-UHFFFAOYSA-M |
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)