cas: 500708-75-8 — see every product listed under this CAS number, including other names
Sodium 5-chlorothiophene-2-sulfinate, 97% (CAS 500708-75-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1028694-5g |
| cas | 500708-75-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7484.89 Pln | |
| AmBeed | 10g | 9379.30 Pln | |
| Fluorochem | 50mg | 331.15 Pln | |
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 500mg | 1018.41 Pln | |
| Fluorochem | 1g | 1466.17 Pln | |
| Fluorochem | 2.5g | 2804.24 Pln | |
| Fluorochem | 5g | 4085.04 Pln | |
| Fluorochem | 10g | 6027.06 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Sodium 5-chlorothiophene-2-sulfinate (CAS 500708-75-8) is a chemical compound with the molecular formula C4H2ClNaO2S2 and a molecular weight of 204.6 g/mol. IUPAC name: sodium 5-chlorothiophene-2-sulfinate. InChIKey: URPDPPVDDGHRPQ-UHFFFAOYSA-M.
| Molecular formula | C4H2ClNaO2S2 |
|---|---|
| Molecular weight | 204.6 g/mol |
| IUPAC name | sodium 5-chlorothiophene-2-sulfinate |
| InChIKey | URPDPPVDDGHRPQ-UHFFFAOYSA-M |
| SMILES | C1=C(SC(=C1)Cl)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)