Sodium bis(oxalato)borate, 98%
cas: 83145-77-1 — see every product listed under this CAS number, including other names
Sodium bis(oxalato)borate, 98% (CAS 83145-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A2418620-1g |
| cas | 83145-77-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 581.75 Pln | |
| Ambeed | 25g | 993.38 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 408.77 Pln | |
| BLDpharm | 10g | 625.36 Pln | |
| BLDpharm | 25g | 1069.65 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 448.40 Pln | |
| Chemat | 25g | 688.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Sodium 1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonane-2,3,7,8-tetrone (CAS 83145-77-1) is a chemical compound with the molecular formula C4BNaO8 and a molecular weight of 209.84 g/mol. IUPAC name: sodium 1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonane-2,3,7,8-tetrone. InChIKey: SOKLULUXCQJYGP-UHFFFAOYSA-N.
| Molecular formula | C4BNaO8 |
|---|---|
| Molecular weight | 209.84 g/mol |
| IUPAC name | sodium 1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonane-2,3,7,8-tetrone |
| InChIKey | SOKLULUXCQJYGP-UHFFFAOYSA-N |
| SMILES | [B-]12(OC(=O)C(=O)O1)OC(=O)C(=O)O2.[Na+] |
Computed by PubChem (NCBI)