Sodium dichlorofluoroacetate, 98%
cas: 2837-90-3 — see every product listed under this CAS number, including other names
Sodium dichlorofluoroacetate, 98% (CAS 2837-90-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A873361-1g |
| cas | 2837-90-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 587.31 Pln | |
| Ambeed | 5g | 1516.25 Pln | |
| Ambeed | 10g | 2361.75 Pln | |
| Ambeed | 25g | 4675.75 Pln | |
| Ambeed | 100g | 16846.50 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 1682.00 Pln | |
| Chemat | 10g | 2632.40 Pln | |
| Chemat | 25g | 5224.40 Pln | |
| Chemat | 100g | 13677.20 Pln | |
| BLDpharm | 1g | 630.91 Pln | |
| BLDpharm | 5g | 1625.01 Pln | |
| BLDpharm | 10g | 2541.35 Pln | |
| BLDpharm | 25g | 5034.92 Pln | |
| BLDpharm | 100g | 16514.21 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Sodium 2,2-dichloro-2-fluoroacetate (CAS 2837-90-3) is a chemical compound with the molecular formula C2Cl2FNaO2 and a molecular weight of 168.91 g/mol. IUPAC name: sodium 2,2-dichloro-2-fluoroacetate. InChIKey: IZJLVZAQCUZJQO-UHFFFAOYSA-M.
| Molecular formula | C2Cl2FNaO2 |
|---|---|
| Molecular weight | 168.91 g/mol |
| IUPAC name | sodium 2,2-dichloro-2-fluoroacetate |
| InChIKey | IZJLVZAQCUZJQO-UHFFFAOYSA-M |
| SMILES | C(=O)(C(F)(Cl)Cl)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
SODIUM DICHLOROFLUOROACETATE, sodium 2,2-dichloro-2-fluoroacetate, Sodium 2,2-dichloro-2-fluoro-acetate, SODIUMDICHLOROFLUOROACETATE, sodium;2,2-dichloro-2-fluoroacetate, Acetic acid, dichlorofluoro-, sodium salt, C2Cl2FNaO2, sodium di-chlorofluoroacetate, Sodium dichloro(fluoro)acetate, Sodium dichlorofluoroacetate 98%