CAS 81686-22-8 appears in our catalog under these names: Sodium ionophore III/ 98.54% (existing batch purity), Sodium ionophore III (ETH2120), SODIUM IONOPHORE III, ETH 2120, 98%, 98%, Sodium ionophore III, 99.55%. Offered by: TargetMol, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250MG, 5 mg.
N,N-dicyclohexyl-2-[2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy]acetamide (CAS 81686-22-8) is a chemical compound with the molecular formula C34H52N2O4 and a molecular weight of 552.8 g/mol. IUPAC name: N,N-dicyclohexyl-2-[2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy]acetamide. InChIKey: GKRBLFCTFPAHMH-UHFFFAOYSA-N.
| Molecular formula | C34H52N2O4 |
|---|---|
| Molecular weight | 552.8 g/mol |
| IUPAC name | N,N-dicyclohexyl-2-[2-[2-(dicyclohexylamino)-2-oxoethoxy]phenoxy]acetamide |
| InChIKey | GKRBLFCTFPAHMH-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N(C2CCCCC2)C(=O)COC3=CC=CC=C3OCC(=O)N(C4CCCCC4)C5CCCCC5 |
Computed by PubChem (NCBI)