CAS 207801-20-5 appears in our catalog under these names: Sodium 4-methylbenzenesulfinate xhydrate, 99%, Sodium p–toluenesulfinate, p-Toluenesulfinic acid, sodium salt hydrate, 98+%, Sodium 4-methylbenzenesulfinate xhydrate, 98%, 98%, Sodium p-toluenesulfinate hydrate, ≥98%. Offered by: AmBeed, GLPBio, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 25g, 5g, 500g, 100g, 2.5kg.
Sodium;4-methylbenzenesulfinate;hydrate (CAS 207801-20-5) is a chemical compound with the molecular formula C7H9NaO3S and a molecular weight of 196.20 g/mol. IUPAC name: sodium;4-methylbenzenesulfinate;hydrate. InChIKey: WUHWAOGAJFMIFU-UHFFFAOYSA-M.
| Molecular formula | C7H9NaO3S |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | sodium;4-methylbenzenesulfinate;hydrate |
| InChIKey | WUHWAOGAJFMIFU-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)