CAS 25112-68-9 appears in our catalog under these names: Sodium Thiophene-2-carboxylate, Sodium thiophene–2–carboxylate, Sodium thiophene-2-carboxylate, 95%, 95%, Sodium thiophene-2-carboxylate, 98%+(LC-MS),RG, Sodium thiophene-2-carboxylate, 95%. Offered by: Mikromol, LoGiCal, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 10mg, 25g, 5g, 10g, 100g, 500g.
Sodium thiophene-2-carboxylate (CAS 25112-68-9) is a chemical compound with the molecular formula C5H3NaO2S and a molecular weight of 150.13 g/mol. IUPAC name: sodium thiophene-2-carboxylate. InChIKey: LKYIPGJOXSVWPX-UHFFFAOYSA-M.
| Molecular formula | C5H3NaO2S |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | sodium thiophene-2-carboxylate |
| InChIKey | LKYIPGJOXSVWPX-UHFFFAOYSA-M |
| SMILES | C1=CSC(=C1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)