cas: 2926-30-9 — see every product listed under this CAS number, including other names
Sodium trifluoromethanesulfonate, 98% (CAS 2926-30-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g, 100g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 358750050 |
| cas | 2926-30-9 |
| size | 5g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 255.69 Pln | |
| Thermo Scientific (Acros) | 25g | 792.89 Pln | |
| Sigma-Aldrich | 25G | 993.00 Pln | |
| Sigma-Aldrich | 5G | 346.00 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 341.56 Pln | |
| Fluorochem | 500g | 1237.08 Pln | |
| Fluorochem | 1kg | 1981.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
Sodium trifluoromethanesulfonate (CAS 2926-30-9) is a chemical compound with the molecular formula CF3NaO3S and a molecular weight of 172.06 g/mol. IUPAC name: sodium trifluoromethanesulfonate. InChIKey: XGPOMXSYOKFBHS-UHFFFAOYSA-M.
| Molecular formula | CF3NaO3S |
|---|---|
| Molecular weight | 172.06 g/mol |
| IUPAC name | sodium trifluoromethanesulfonate |
| InChIKey | XGPOMXSYOKFBHS-UHFFFAOYSA-M |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)