cas: 170858-33-0 — see every product listed under this CAS number, including other names
Sonepiprazole (CAS 170858-33-0) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg. Offered by: TargetMol, GLPBio.
| brand | TargetMol |
|---|---|
| catalog number | T23380-2mg |
| cas | 170858-33-0 |
| size | 2mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 399.00 Pln | |
| TargetMol | 5mg | 532.05 Pln | |
| TargetMol | 10mg | 737.76 Pln | |
| TargetMol | 25mg | 1395.14 Pln | |
| TargetMol | 50mg | 2231.97 Pln | |
| TargetMol | 100mg | 3135.31 Pln | |
| TargetMol | 200mg | 4330.45 Pln | |
| GLPBio | 1mg | 615.76 Pln | |
| GLPBio | 10mg | 1331.88 Pln | |
| GLPBio | 5mg | 924.67 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
4-[4-[2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl]piperazin-1-yl]benzenesulfonamide (CAS 170858-33-0) is a chemical compound with the molecular formula C21H27N3O3S and a molecular weight of 401.5 g/mol. IUPAC name: 4-[4-[2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl]piperazin-1-yl]benzenesulfonamide. InChIKey: WNUQCGWXPNGORO-NRFANRHFSA-N.
| Molecular formula | C21H27N3O3S |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 4-[4-[2-[(1S)-3,4-dihydro-1H-isochromen-1-yl]ethyl]piperazin-1-yl]benzenesulfonamide |
| InChIKey | WNUQCGWXPNGORO-NRFANRHFSA-N |
| SMILES | C1CO[C@H](C2=CC=CC=C21)CCN3CCN(CC3)C4=CC=C(C=C4)S(=O)(=O)N |
Computed by PubChem (NCBI)