cas: 92638-81-8 — see every product listed under this CAS number, including other names
Spiro[acridine-9(10H),9'-[9H]fluorene], 98%, 98% (CAS 92638-81-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140O9-100mg |
| cas | 92638-81-8 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2541.20 Pln | |
| Chemat | 100g | 4542.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Spiro[10H-acridine-9,9'-fluorene] (CAS 92638-81-8) is a chemical compound with the molecular formula C25H17N and a molecular weight of 331.4 g/mol. IUPAC name: spiro[10H-acridine-9,9'-fluorene]. InChIKey: GFOZRCASAHKFFT-UHFFFAOYSA-N.
| Molecular formula | C25H17N |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | spiro[10H-acridine-9,9'-fluorene] |
| InChIKey | GFOZRCASAHKFFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C24C5=CC=CC=C5NC6=CC=CC=C46 |
Computed by PubChem (NCBI)