Spiro[chroman-2,4'-piperidin]-6-ol, 95%
cas: 1174924-16-3 — see every product listed under this CAS number, including other names
Spiro[chroman-2,4'-piperidin]-6-ol, 95% (CAS 1174924-16-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A263807-100mg |
| cas | 1174924-16-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 776.44 Pln | |
| Ambeed | 250mg | 1271.50 Pln | |
| Ambeed | 1g | 3301.81 Pln | |
| BLDpharm | 100mg | 836.40 Pln | |
| BLDpharm | 250mg | 1363.99 Pln | |
| BLDpharm | 1g | 3557.66 Pln | |
| Chemat | 100mg | 779.60 Pln | |
| Chemat | 250mg | 1278.80 Pln | |
| Chemat | 1g | 3342.80 Pln | |
| Fluorochem | 1g | 6204.08 Pln | |
| Fluorochem | 100mg | 1445.34 Pln | |
| Fluorochem | 250mg | 2366.89 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Spiro[3,4-dihydrochromene-2,4'-piperidine]-6-ol (CAS 1174924-16-3) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: spiro[3,4-dihydrochromene-2,4'-piperidine]-6-ol. InChIKey: VBNMQAAVTMCEGO-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | spiro[3,4-dihydrochromene-2,4'-piperidine]-6-ol |
| InChIKey | VBNMQAAVTMCEGO-UHFFFAOYSA-N |
| SMILES | C1CC2(CCNCC2)OC3=C1C=C(C=C3)O |
Computed by PubChem (NCBI)