Spiro[chroman-2,4'-piperidine], 95+%
cas: 147372-85-8 — see every product listed under this CAS number, including other names
Spiro[chroman-2,4'-piperidine], 95+% (CAS 147372-85-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A171842-250mg |
| cas | 147372-85-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1087.94 Pln | |
| Ambeed | 1g | 2517.50 Pln | |
| Ambeed | 5g | 6444.62 Pln | |
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1331.60 Pln | |
| Chemat | 1g | 3098.00 Pln | |
| Chemat | 5g | 6957.20 Pln | |
| BLDpharm | 100mg | 758.65 Pln | |
| BLDpharm | 250mg | 1336.22 Pln | |
| BLDpharm | 1g | 3102.27 Pln | |
| BLDpharm | 5g | 6945.36 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Spiro[3,4-dihydrochromene-2,4'-piperidine] (CAS 147372-85-8) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: spiro[3,4-dihydrochromene-2,4'-piperidine]. InChIKey: IDKWKFTXXFZPQK-UHFFFAOYSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | spiro[3,4-dihydrochromene-2,4'-piperidine] |
| InChIKey | IDKWKFTXXFZPQK-UHFFFAOYSA-N |
| SMILES | C1CC2(CCNCC2)OC3=CC=CC=C31 |
Computed by PubChem (NCBI)
Synonyms:
Spiro[chroman-2,4'-piperidine], spiro[chromane-2,4'-piperidine], Spiro[chroMan-2,4/'-piperidine], Spiro[chroman-2,4'-piperidine, spiro[3,4-dihydrochromene-2,4'-piperidine], Spiro[2H-1-benzopyran-2,4'-piperidine], 3,4-dihydro-, 3,4-Dihydrospiro[2H-1-benzopyran-2,4'-piperidine], 3,4-dihydrospiro[1-benzopyran-2,4'-piperidine], Spiro[chromane-2,4'-piperidine, IDKWKFTXXFZPQK-UHFFFAOYSA-N
![Spiro[chromane-2,4'-piperidine], 95+%](https://cdn.chemat.com.pl/products/images/f903b0607f03ee438270bd8c30285da3ed358538636aac9fc868d1a7d71125f0.svg)