Staurosporine, 98%
cas: 62996-74-1 — see every product listed under this CAS number, including other names
Staurosporine, 98% (CAS 62996-74-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 2mg, 5mg, 1MG, 250UG, 25mg, 50mg, 100mg. Offered by: AmBeed, Thermo Scientific (Acros), Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A256460-10mg |
| cas | 62996-74-1 |
| size | 10mg |
| availability | USA Stock: 9.217g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10mg | 398.10 Pln | |
| AmBeed | 2mg | 221.03 Pln | |
| AmBeed | 5mg | 288.74 Pln | |
| Thermo Scientific (Acros) | 1MG | 3790.74 Pln | |
| Thermo Scientific (Acros) | 250UG | 1385.33 Pln | |
| Fluorochem | 5mg | 180.16 Pln | |
| Fluorochem | 25mg | 294.71 Pln | |
| Fluorochem | 50mg | 414.46 Pln | |
| Fluorochem | 100mg | 549.82 Pln | |
| Fluorochem | 250mg | 726.85 Pln | |
| Fluorochem | 500mg | 1138.16 Pln | |
| Fluorochem | 1g | 1710.87 Pln | |
| Ambeed | 250mg | 1182.50 Pln | |
| Ambeed | 1g | 2450.75 Pln | |
| Ambeed | 5g | 7212.25 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 2mg | 102.80 Pln | |
| Chemat | 5mg | 131.60 Pln | |
| Chemat | 10mg | 174.80 Pln | |
| Chemat | 25mg | 184.40 Pln | |
| Chemat | 50mg | 256.40 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 500mg | 683.60 Pln | |
| Chemat | 1g | 957.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Staurosporine is an indolocarbazole alkaloid and an organic heterooctacyclic compound. It has a role as a geroprotector, an EC 2.7.11.13 (protein kinase C) inhibitor, an apoptosis inducer and a bacterial metabolite. It is a conjugate base of a staurosporinium.
Source: ChEBI
| Molecular formula | C28H26N4O3 |
|---|---|
| Molecular weight | 466.5 g/mol |
| IUPAC name | (2S,3R,4R,6R)-3-methoxy-2-methyl-4-(methylamino)-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-16-one |
| InChIKey | HKSZLNNOFSGOKW-FYTWVXJKSA-N |
| SMILES | C[C@@]12[C@@H]([C@@H](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC |
Computed by PubChem (NCBI)