cas: 135459-87-9 — see every product listed under this CAS number, including other names
Strontium Ranelate 98% (CAS 135459-87-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 100mg, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A162052-10mg |
| cas | 135459-87-9 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 120.06 Pln | |
| Ambeed | 50mg | 131.19 Pln | |
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A162052 |
Distrontium;5-[bis(carboxylatomethyl)amino]-3-(carboxylatomethyl)-4-cyanothiophene-2-carboxylate (CAS 135459-87-9) is a chemical compound with the molecular formula C12H6N2O8SSr2 and a molecular weight of 513.5 g/mol. IUPAC name: distrontium;5-[bis(carboxylatomethyl)amino]-3-(carboxylatomethyl)-4-cyanothiophene-2-carboxylate. InChIKey: XXUZFRDUEGQHOV-UHFFFAOYSA-J.
| Molecular formula | C12H6N2O8SSr2 |
|---|---|
| Molecular weight | 513.5 g/mol |
| IUPAC name | distrontium;5-[bis(carboxylatomethyl)amino]-3-(carboxylatomethyl)-4-cyanothiophene-2-carboxylate |
| InChIKey | XXUZFRDUEGQHOV-UHFFFAOYSA-J |
| SMILES | C(C1=C(SC(=C1C#N)N(CC(=O)[O-])CC(=O)[O-])C(=O)[O-])C(=O)[O-].[Sr+2].[Sr+2] |
Computed by PubChem (NCBI)