Strontium Ranelate, 98%
cas: 135459-87-9 — see every product listed under this CAS number, including other names
Strontium Ranelate, 98% (CAS 135459-87-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 10g, 25g, 100g, 500g, 1mg, 10mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A162052-100mg |
| cas | 135459-87-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Ambeed | 100g | 309.19 Pln | |
| Ambeed | 500g | 926.62 Pln | |
| Chemat | 1mg | 83.60 Pln | |
| Chemat | 10mg | 88.40 Pln | |
| Chemat | 50mg | 93.20 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 333.20 Pln | |
| Chemat | 100g | 539.60 Pln | |
| Chemat | 500g | 1804.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Distrontium;5-[bis(carboxylatomethyl)amino]-3-(carboxylatomethyl)-4-cyanothiophene-2-carboxylate (CAS 135459-87-9) is a chemical compound with the molecular formula C12H6N2O8SSr2 and a molecular weight of 513.5 g/mol. IUPAC name: distrontium;5-[bis(carboxylatomethyl)amino]-3-(carboxylatomethyl)-4-cyanothiophene-2-carboxylate. InChIKey: XXUZFRDUEGQHOV-UHFFFAOYSA-J.
| Molecular formula | C12H6N2O8SSr2 |
|---|---|
| Molecular weight | 513.5 g/mol |
| IUPAC name | distrontium;5-[bis(carboxylatomethyl)amino]-3-(carboxylatomethyl)-4-cyanothiophene-2-carboxylate |
| InChIKey | XXUZFRDUEGQHOV-UHFFFAOYSA-J |
| SMILES | C(C1=C(SC(=C1C#N)N(CC(=O)[O-])CC(=O)[O-])C(=O)[O-])C(=O)[O-].[Sr+2].[Sr+2] |
Computed by PubChem (NCBI)