cas: 967-80-6 — see every product listed under this CAS number, including other names
Sulfaquinoxaline sodium salt 98% (CAS 967-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323798-100mg |
| cas | 967-80-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 186.81 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 353.69 Pln | |
| Ambeed | 25g | 642.94 Pln | |
| Ambeed | 100g | 1354.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A323798 |
Sodium (4-aminophenyl)sulfonyl-quinoxalin-2-ylazanide (CAS 967-80-6) is a chemical compound with the molecular formula C14H11N4NaO2S and a molecular weight of 322.32 g/mol. IUPAC name: sodium (4-aminophenyl)sulfonyl-quinoxalin-2-ylazanide. InChIKey: WXUQBKOBXREBBX-UHFFFAOYSA-N.
| Molecular formula | C14H11N4NaO2S |
|---|---|
| Molecular weight | 322.32 g/mol |
| IUPAC name | sodium (4-aminophenyl)sulfonyl-quinoxalin-2-ylazanide |
| InChIKey | WXUQBKOBXREBBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)[N-]S(=O)(=O)C3=CC=C(C=C3)N.[Na+] |
Computed by PubChem (NCBI)