CAS 3520-42-1 appears in our catalog under these names: Acid Red 52, Sulforhodamine B Sodium Salt, Sulforhodamine B sodium salt/ 72% (existing batch purity), Sulforhodamine B sodium salt (Acid Red 52), Sulforhodamine B sodium salt . Offered by: Dr. Ehrenstorfer, TRC, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 1g, 5g, 25g, 100g, 50g, 250g, 500g.
Lissamine rhodamine is an organic sodium salt having 4-[3,6-bis(diethylamino)xanthenium-9-yl]benzene-1,3-disulfonate as the counterion. It has a role as a fluorescent probe, a fluorochrome and a histological dye. It contains a lissamine rhodamine anion.
Source: ChEBI
| Molecular formula | C27H29N2NaO7S2 |
|---|---|
| Molecular weight | 580.7 g/mol |
| IUPAC name | sodium 4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]benzene-1,3-disulfonate |
| InChIKey | SXQCTESRRZBPHJ-UHFFFAOYSA-M |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)