Sunvozertinib, 98%, 98%
cas: 2370013-12-8 — see every product listed under this CAS number, including other names
Sunvozertinib, 98%, 98% (CAS 2370013-12-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134P4Q-1mg |
| cas | 2370013-12-8 |
| size | 1mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 5mg | 126.80 Pln | |
| Chemat | 10mg | 146.00 Pln | |
| Chemat | 25mg | 218.00 Pln | |
| Chemat | 50mg | 314.00 Pln | |
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 918.80 Pln | |
| Chemat | 1g | 2483.60 Pln | |
| Chemat | 5g | 9746.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[5-[[4-[5-chloro-4-fluoro-2-(2-hydroxypropan-2-yl)anilino]pyrimidin-2-yl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methoxyphenyl]prop-2-enamide (CAS 2370013-12-8) is a chemical compound with the molecular formula C29H35ClFN7O3 and a molecular weight of 584.1 g/mol. IUPAC name: N-[5-[[4-[5-chloro-4-fluoro-2-(2-hydroxypropan-2-yl)anilino]pyrimidin-2-yl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methoxyphenyl]prop-2-enamide. InChIKey: BTMKEDDEMKKSEF-QGZVFWFLSA-N.
| Molecular formula | C29H35ClFN7O3 |
|---|---|
| Molecular weight | 584.1 g/mol |
| IUPAC name | N-[5-[[4-[5-chloro-4-fluoro-2-(2-hydroxypropan-2-yl)anilino]pyrimidin-2-yl]amino]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-4-methoxyphenyl]prop-2-enamide |
| InChIKey | BTMKEDDEMKKSEF-QGZVFWFLSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1NC2=NC(=NC=C2)NC3=C(C=C(C(=C3)NC(=O)C=C)N4CC[C@H](C4)N(C)C)OC)Cl)F)O |
Computed by PubChem (NCBI)