cas: 131326-39-1 — see every product listed under this CAS number, including other names
TBS-PEG2-OH, 99.07% (CAS 131326-39-1) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 100 g, 10 g, 25 g, 50 g, 500 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W044212-5 g |
| cas | 131326-39-1 |
| size | 5 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 333.62 Pln | |
| MedChemExpress | 100 g | 1104.53 Pln | |
| MedChemExpress | 10 g | 407.93 Pln | |
| MedChemExpress | 25 g | 579.76 Pln | |
| MedChemExpress | 50 g | 765.52 Pln | |
| MedChemExpress | 500 g | 3096.80 Pln | |
| MedChemExpress | 1 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.07% |
2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethanol (CAS 131326-39-1) is a chemical compound with the molecular formula C10H24O3Si and a molecular weight of 220.38 g/mol. IUPAC name: 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethanol. InChIKey: LDVVVUYQPMCVTA-UHFFFAOYSA-N.
| Molecular formula | C10H24O3Si |
|---|---|
| Molecular weight | 220.38 g/mol |
| IUPAC name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]ethanol |
| InChIKey | LDVVVUYQPMCVTA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCCO |
Computed by PubChem (NCBI)