cas: 1802913-21-8 — see every product listed under this CAS number, including other names
TCO-PEG4-acid, 95% (E), 95% (E) (CAS 1802913-21-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I124-50mg |
| cas | 1802913-21-8 |
| size | 50mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 2037.20 Pln | |
| Chemat | 100mg | 3424.40 Pln | |
| Chemat | 250mg | 4432.40 Pln |
| purity | 95% (E) |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1802913-21-8) is a chemical compound with the molecular formula C20H35NO8 and a molecular weight of 417.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: PSNKSDUNMXNXDE-UPHRSURJSA-N.
| Molecular formula | C20H35NO8 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | PSNKSDUNMXNXDE-UPHRSURJSA-N |
| SMILES | C1C/C=C\CCC(C1)OC(=O)NCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)