cas: 125700-69-8 — see every product listed under this CAS number, including other names
TDBTU, 95% (CAS 125700-69-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024899-10G |
| cas | 125700-69-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 810.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[dimethylamino-[(4-oxo-1,2,3-benzotriazin-3-yl)oxy]methylidene]-dimethylazanium tetrafluoroborate (CAS 125700-69-8) is a chemical compound with the molecular formula C12H16BF4N5O2 and a molecular weight of 349.09 g/mol. IUPAC name: [dimethylamino-[(4-oxo-1,2,3-benzotriazin-3-yl)oxy]methylidene]-dimethylazanium tetrafluoroborate. InChIKey: FOBCPCIJLQTYBT-UHFFFAOYSA-N.
| Molecular formula | C12H16BF4N5O2 |
|---|---|
| Molecular weight | 349.09 g/mol |
| IUPAC name | [dimethylamino-[(4-oxo-1,2,3-benzotriazin-3-yl)oxy]methylidene]-dimethylazanium tetrafluoroborate |
| InChIKey | FOBCPCIJLQTYBT-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CN(C)C(=[N+](C)C)ON1C(=O)C2=CC=CC=C2N=N1 |
Computed by PubChem (NCBI)