cas: 908334-27-0 — see every product listed under this CAS number, including other names
TERT-BUTYL 2-(3-AMINOPHENYL)PIPERIDINE-1-CARBOXYLATE, 97% (CAS 908334-27-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F529411-100MG |
| cas | 908334-27-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1174.60 Pln | |
| Fluorochem | 250mg | 1533.85 Pln | |
| Fluorochem | 500mg | 2517.88 Pln | |
| Fluorochem | 1g | 3736.20 Pln | |
| Fluorochem | 5g | 12030.16 Pln | |
| Fluorochem | 10g | 20011.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(3-aminophenyl)piperidine-1-carboxylate (CAS 908334-27-0) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: tert-butyl 2-(3-aminophenyl)piperidine-1-carboxylate. InChIKey: URRTXXSKMLRQHG-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | tert-butyl 2-(3-aminophenyl)piperidine-1-carboxylate |
| InChIKey | URRTXXSKMLRQHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)