cas: 2246556-84-1 — see every product listed under this CAS number, including other names
TERT-BUTYL 2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-6,7-DIHYDROTHIENO[3,2-C]PYRIDINE-5(4H)-CARBOXYLATE, 98% (CAS 2246556-84-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F852647-100MG |
| cas | 2246556-84-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 1986.82 Pln | |
| Fluorochem | 5g | 6391.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate (CAS 2246556-84-1) is a chemical compound with the molecular formula C18H28BNO4S and a molecular weight of 365.3 g/mol. IUPAC name: tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate. InChIKey: PNURUDISZTVTLZ-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4S |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | tert-butyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | PNURUDISZTVTLZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(S2)CCN(C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)