cas: 374794-96-4 — see every product listed under this CAS number, including other names
TERT-BUTYL 2-OXA-8-AZASPIRO[4.5]DECANE-8-CARBOXYLATE (CAS 374794-96-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467033-250MG |
| cas | 374794-96-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1268.32 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 2-oxa-8-azaspiro[4.5]decane-8-carboxylate (CAS 374794-96-4) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 2-oxa-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: JHFMRJOXVOCJJQ-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 2-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | JHFMRJOXVOCJJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CCOC2 |
Computed by PubChem (NCBI)