cas: 1138331-90-4 — see every product listed under this CAS number, including other names
TERT-BUTYL 3-(1-HYDROXYETHYL)AZETIDINE-1-CARBOXYLATE, 97% (CAS 1138331-90-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502468-100MG |
| cas | 1138331-90-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 500mg | 508.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(1-hydroxyethyl)azetidine-1-carboxylate (CAS 1138331-90-4) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl 3-(1-hydroxyethyl)azetidine-1-carboxylate. InChIKey: FOEGASXWOTWMKN-UHFFFAOYSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl 3-(1-hydroxyethyl)azetidine-1-carboxylate |
| InChIKey | FOEGASXWOTWMKN-UHFFFAOYSA-N |
| SMILES | CC(C1CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)