cas: 1467060-28-1 — see every product listed under this CAS number, including other names
TERT-BUTYL 3-(4-BROMOPHENYL)PYRROLIDINE-1-CARBOXYLATE, 95% (CAS 1467060-28-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472751-50MG |
| cas | 1467060-28-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 2106.57 Pln | |
| Fluorochem | 100mg | 3501.91 Pln | |
| Fluorochem | 250mg | 5782.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 3-(4-bromophenyl)pyrrolidine-1-carboxylate (CAS 1467060-28-1) is a chemical compound with the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. IUPAC name: tert-butyl 3-(4-bromophenyl)pyrrolidine-1-carboxylate. InChIKey: NFTKVQYDQFSNHQ-UHFFFAOYSA-N.
| Molecular formula | C15H20BrNO2 |
|---|---|
| Molecular weight | 326.23 g/mol |
| IUPAC name | tert-butyl 3-(4-bromophenyl)pyrrolidine-1-carboxylate |
| InChIKey | NFTKVQYDQFSNHQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)