cas: 1186688-52-7 — see every product listed under this CAS number, including other names
TERT-BUTYL 4,4-DIFLUORO-3-HYDROXYPIPERIDINE-1-CARBOXYLATE, 97% (CAS 1186688-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F813718-100MG |
| cas | 1186688-52-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 857.01 Pln | |
| Fluorochem | 250mg | 1419.31 Pln | |
| Fluorochem | 500mg | 2257.56 Pln | |
| Fluorochem | 1g | 3798.68 Pln | |
| Fluorochem | 5g | 12123.87 Pln | |
| Fluorochem | 10g | 22339.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4,4-difluoro-3-hydroxypiperidine-1-carboxylate (CAS 1186688-52-7) is a chemical compound with the molecular formula C10H17F2NO3 and a molecular weight of 237.24 g/mol. IUPAC name: tert-butyl 4,4-difluoro-3-hydroxypiperidine-1-carboxylate. InChIKey: WMSNGRGUQYKMEF-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO3 |
|---|---|
| Molecular weight | 237.24 g/mol |
| IUPAC name | tert-butyl 4,4-difluoro-3-hydroxypiperidine-1-carboxylate |
| InChIKey | WMSNGRGUQYKMEF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)O)(F)F |
Computed by PubChem (NCBI)