cas: 959239-07-7 — see every product listed under this CAS number, including other names
TERT-BUTYL 4-(2-BROMOETHOXY)PHENYLCARBAMATE, ≥95%, ≥95% (CAS 959239-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12SYOX-1g |
| cas | 959239-07-7 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 3851.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[4-(2-bromoethoxy)phenyl]carbamate (CAS 959239-07-7) is a chemical compound with the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. IUPAC name: tert-butyl N-[4-(2-bromoethoxy)phenyl]carbamate. InChIKey: WBFZSVLIQOAVEV-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO3 |
|---|---|
| Molecular weight | 316.19 g/mol |
| IUPAC name | tert-butyl N-[4-(2-bromoethoxy)phenyl]carbamate |
| InChIKey | WBFZSVLIQOAVEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)OCCBr |
Computed by PubChem (NCBI)