cas: 189763-86-8 — see every product listed under this CAS number, including other names
TERT-BUTYL 4-(4-ACETYLPHENYL)PIPERAZINE-1-CARBOXYLATE, 97%, 97% (CAS 189763-86-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I3SO-1g |
| cas | 189763-86-8 |
| size | 1g |
| availability | 18g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1269.20 Pln | |
| Chemat | 10g | 2234.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4-acetylphenyl)piperazine-1-carboxylate (CAS 189763-86-8) is a chemical compound with the molecular formula C17H24N2O3 and a molecular weight of 304.4 g/mol. IUPAC name: tert-butyl 4-(4-acetylphenyl)piperazine-1-carboxylate. InChIKey: RNENNIIGKWIJDK-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O3 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tert-butyl 4-(4-acetylphenyl)piperazine-1-carboxylate |
| InChIKey | RNENNIIGKWIJDK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)