Products 5922-92-9

CAS 5922-92-9 appears in our catalog under these names: Tetrahexylammonium chloride, 95%, TETRAHEXYLAMMONIUM CHLORIDE, 96%, Tetrahexylammonium chloride, 96%(HPLC),RG, 96%(HPLC),RG, TETRAHEXYLAMMONIUM CHLORIDE, 96%,RG. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Tetrahexylazanium chloride (CAS 5922-92-9) is a chemical compound with the molecular formula C24H52ClN and a molecular weight of 390.1 g/mol. IUPAC name: tetrahexylazanium chloride. InChIKey: ODTSDWCGLRVBHJ-UHFFFAOYSA-M.

Identity
Molecular formulaC24H52ClN
Molecular weight390.1 g/mol
IUPAC nametetrahexylazanium chloride
InChIKeyODTSDWCGLRVBHJ-UHFFFAOYSA-M
SMILESCCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.[Cl-]

Computed by PubChem (NCBI)