cas: 996-70-3 — see every product listed under this CAS number, including other names
TETRAKIS(DIMETHYLAMINO)ETHYLENE, 85% (CAS 996-70-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F812049-50MG |
| cas | 996-70-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 185.37 Pln | |
| Fluorochem | 5g | 5339.80 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 85% |
|---|---|
| delivery time | 2-3 weeks |
1-N,1-N,1-N',1-N',2-N,2-N,2-N',2-N'-octamethylethene-1,1,2,2-tetramine (CAS 996-70-3) is a chemical compound with the molecular formula C10H24N4 and a molecular weight of 200.32 g/mol. IUPAC name: 1-N,1-N,1-N',1-N',2-N,2-N,2-N',2-N'-octamethylethene-1,1,2,2-tetramine. InChIKey: CBXRMKZFYQISIV-UHFFFAOYSA-N.
| Molecular formula | C10H24N4 |
|---|---|
| Molecular weight | 200.32 g/mol |
| IUPAC name | 1-N,1-N,1-N',1-N',2-N,2-N,2-N',2-N'-octamethylethene-1,1,2,2-tetramine |
| InChIKey | CBXRMKZFYQISIV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=C(N(C)C)N(C)C)N(C)C |
Computed by PubChem (NCBI)