cas: 170942-79-7 — see every product listed under this CAS number, including other names
TRANS-4,4,5,5-TETRAMETHYL-2-OCT-1-ENYL-1,3,2-DIOXABOROLANE, 95% (CAS 170942-79-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F860764-1G |
| cas | 170942-79-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 612.30 Pln | |
| Fluorochem | 250mg | 279.09 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-[(E)-oct-1-enyl]-1,3,2-dioxaborolane (CAS 170942-79-7) is a chemical compound with the molecular formula C14H27BO2 and a molecular weight of 238.18 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-oct-1-enyl]-1,3,2-dioxaborolane. InChIKey: KQTOSGTXAFJZSJ-VAWYXSNFSA-N.
| Molecular formula | C14H27BO2 |
|---|---|
| Molecular weight | 238.18 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-oct-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | KQTOSGTXAFJZSJ-VAWYXSNFSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCCCCC |
Computed by PubChem (NCBI)