cas: 141136-83-6 — see every product listed under this CAS number, including other names
TRAP-6 98% TFA salt (CAS 141136-83-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A693456-1mg |
| cas | 141136-83-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 303.62 Pln | |
| Ambeed | 2mg | 364.81 Pln | |
| Ambeed | 5mg | 453.81 Pln | |
| Ambeed | 10mg | 559.50 Pln | |
| Ambeed | 25mg | 704.12 Pln | |
| Ambeed | 100mg | 887.69 Pln | |
| Ambeed | 250mg | 1621.94 Pln | |
| Ambeed | 1g | 4241.88 Pln |
| purity | 98% TFA salt |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A693456 |
(2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid (CAS 141136-83-6) is a chemical compound with the molecular formula C34H56N10O9 and a molecular weight of 748.9 g/mol. IUPAC name: (2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid. InChIKey: HAGOWCONESKMDW-FRSCJGFNSA-N.
| Molecular formula | C34H56N10O9 |
|---|---|
| Molecular weight | 748.9 g/mol |
| IUPAC name | (2S)-4-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoic acid |
| InChIKey | HAGOWCONESKMDW-FRSCJGFNSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(=O)N)C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CO)N |
Computed by PubChem (NCBI)