cas: 7392-50-9 — see every product listed under this CAS number, including other names
TRIBUTYL(ETHYL)PHOSPHONIUM BROMIDE, 98% (CAS 7392-50-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F817939-25G |
| cas | 7392-50-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 508.17 Pln | |
| Fluorochem | 100g | 1408.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tributyl(ethyl)phosphanium bromide (CAS 7392-50-9) is a chemical compound with the molecular formula C14H32BrP and a molecular weight of 311.28 g/mol. IUPAC name: tributyl(ethyl)phosphanium bromide. InChIKey: XOTZDSWJKMKAMT-UHFFFAOYSA-M.
| Molecular formula | C14H32BrP |
|---|---|
| Molecular weight | 311.28 g/mol |
| IUPAC name | tributyl(ethyl)phosphanium bromide |
| InChIKey | XOTZDSWJKMKAMT-UHFFFAOYSA-M |
| SMILES | CCCC[P+](CC)(CCCC)CCCC.[Br-] |
Computed by PubChem (NCBI)