cas: 1180-95-6 — see every product listed under this CAS number, including other names
Taurodeoxycholate sodium salt 95% (CAS 1180-95-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108663-250mg |
| cas | 1180-95-6 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 481.62 Pln | |
| Ambeed | 25g | 1099.06 Pln | |
| Ambeed | 100g | 4191.81 Pln | |
| Ambeed | 500g | 8035.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108663 |
Sodium 2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonate (CAS 1180-95-6) is a chemical compound with the molecular formula C26H44NNaO6S and a molecular weight of 521.7 g/mol. IUPAC name: sodium 2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonate. InChIKey: YXHRQQJFKOHLAP-FVCKGWAHSA-M.
| Molecular formula | C26H44NNaO6S |
|---|---|
| Molecular weight | 521.7 g/mol |
| IUPAC name | sodium 2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonate |
| InChIKey | YXHRQQJFKOHLAP-FVCKGWAHSA-M |
| SMILES | C[C@H](CCC(=O)NCCS(=O)(=O)[O-])[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C.[Na+] |
Computed by PubChem (NCBI)