CAS 2685873-44-1 appears in our catalog under these names: Tazemetostat de(methyl morpholine)-COOH, 98%, Tazemetostat de(methyl morpholine)–COOH, Tazemetostat de(methyl morpholine)-COOH, 98.50%, 98.50%, Tazemetostat de(methyl morpholine)-COOH, 98.15%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 1mg, 10 mg, 50 mg, 10mM/1mL.
4-[3-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylcarbamoyl]-5-[ethyl(oxan-4-yl)amino]-4-methylphenyl]benzoic acid (CAS 2685873-44-1) is a chemical compound with the molecular formula C30H35N3O5 and a molecular weight of 517.6 g/mol. IUPAC name: 4-[3-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylcarbamoyl]-5-[ethyl(oxan-4-yl)amino]-4-methylphenyl]benzoic acid. InChIKey: MIEXIPQREXYLRA-UHFFFAOYSA-N.
| Molecular formula | C30H35N3O5 |
|---|---|
| Molecular weight | 517.6 g/mol |
| IUPAC name | 4-[3-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylcarbamoyl]-5-[ethyl(oxan-4-yl)amino]-4-methylphenyl]benzoic acid |
| InChIKey | MIEXIPQREXYLRA-UHFFFAOYSA-N |
| SMILES | CCN(C1CCOCC1)C2=CC(=CC(=C2C)C(=O)NCC3=C(C=C(NC3=O)C)C)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)