CAS 2738719-07-6 appears in our catalog under these names: Tenofovir diphosphate disodium, Sodium (R)-(((1-(6-amino-9H-purin-9-yl)propan-2-yl)oxy)methyl)phosphonic diphosphoric anhydride, 98%, 98%, Tenofovir diphosphate (disodium), 99.42%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10 mg, 5 mg, 100 mg, 1 mg, 50 mg, 25 mg.
CAS 2738719-07-6 identifies a chemical compound with the molecular formula C9H16N5Na2O10P3 and a molecular weight of 493.15 g/mol. InChIKey: PUFMXPADRYEPCZ-QYCVXMPOSA-N.
| Molecular formula | C9H16N5Na2O10P3 |
|---|---|
| Molecular weight | 493.15 g/mol |
| InChIKey | PUFMXPADRYEPCZ-QYCVXMPOSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)OP(=O)(O)OP(=O)(O)O.[Na].[Na] |
Computed by PubChem (NCBI)