cas: 1932009-15-8 — see every product listed under this CAS number, including other names
Tert-Butyl (1S,4R)-2-Azabicyclo[2.2.1]Heptane-2-Carboxylate, 97% (CAS 1932009-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11PLRD-100mg |
| cas | 1932009-15-8 |
| size | 100mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 500mg | 558.80 Pln | |
| Chemat | 1g | 813.20 Pln | |
| Chemat | 5g | 2315.60 Pln | |
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 500mg | 1023.62 Pln | |
| Fluorochem | 1g | 1507.82 Pln | |
| Fluorochem | 5g | 4288.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (1S,4R)-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 1932009-15-8) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: tert-butyl (1S,4R)-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: AJYDSJWVRJUFMI-BDAKNGLRSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | tert-butyl (1S,4R)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | AJYDSJWVRJUFMI-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@H]1C2 |
Computed by PubChem (NCBI)