cas: 1095708-32-9 — see every product listed under this CAS number, including other names
Tert-Butyl (4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)carbamate, 97%, 97% (CAS 1095708-32-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119U1B-100mg |
| cas | 1095708-32-9 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 717.20 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 3050.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate (CAS 1095708-32-9) is a chemical compound with the molecular formula C16H25BN2O4 and a molecular weight of 320.2 g/mol. IUPAC name: tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate. InChIKey: SAAGMIHGVLKZBC-UHFFFAOYSA-N.
| Molecular formula | C16H25BN2O4 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]carbamate |
| InChIKey | SAAGMIHGVLKZBC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)