cas: 1421312-15-3 — see every product listed under this CAS number, including other names
Tert-Butyl 2-Methyl-7,8-Dihydropyrido[3,2-d]Pyrimidine-5(6H)-Carboxylate, 98%, 98% (CAS 1421312-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HWCO-100mg |
| cas | 1421312-15-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 635.60 Pln | |
| Chemat | 1g | 1854.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-methyl-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate (CAS 1421312-15-3) is a chemical compound with the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. IUPAC name: tert-butyl 2-methyl-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate. InChIKey: TZXSHLLUAWYBMZ-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2 |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | tert-butyl 2-methyl-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate |
| InChIKey | TZXSHLLUAWYBMZ-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2C(=N1)CCCN2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)