cas: 160132-54-7 — see every product listed under this CAS number, including other names
Tert-Butyl 3-(2-hydroxyethyl)pyrrolidine-1-carboxylate, 98%, 98% (CAS 160132-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RP8-100mg |
| cas | 160132-54-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 333.20 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 2896.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(2-hydroxyethyl)pyrrolidine-1-carboxylate (CAS 160132-54-7) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl 3-(2-hydroxyethyl)pyrrolidine-1-carboxylate. InChIKey: OYRWWTPZWOPIOO-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl 3-(2-hydroxyethyl)pyrrolidine-1-carboxylate |
| InChIKey | OYRWWTPZWOPIOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)CCO |
Computed by PubChem (NCBI)