cas: 659747-06-5 — see every product listed under this CAS number, including other names
tert-Butyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate, 95% (CAS 659747-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1091692-100mg |
| cas | 659747-06-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 804.25 Pln | |
| Ambeed | 250mg | 1538.50 Pln | |
| Chemat | 100mg | 794.00 Pln | |
| Chemat | 250mg | 1518.80 Pln | |
| Chemat | 1g | 2978.00 Pln | |
| BLDpharm | 100mg | 864.16 Pln | |
| BLDpharm | 250mg | 1658.33 Pln | |
| BLDpharm | 1g | 3230.00 Pln | |
| Fluorochem | 100mg | 1466.17 Pln | |
| Fluorochem | 250mg | 2825.06 Pln | |
| Fluorochem | 1g | 5522.03 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate (CAS 659747-06-5) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: tert-butyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate. InChIKey: VSLZXCDAPVPGOX-BQBZGAKWSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | tert-butyl (2S,4S)-4-hydroxypyrrolidine-2-carboxylate |
| InChIKey | VSLZXCDAPVPGOX-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](CN1)O |
Computed by PubChem (NCBI)