cas: 166955-02-8 — see every product listed under this CAS number, including other names
Tert-butyl 2-(4-hydroxypiperidin-1-yl)acetate, 97% (CAS 166955-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F770783-100MG |
| cas | 166955-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 560.24 Pln | |
| Fluorochem | 250mg | 893.45 Pln | |
| Fluorochem | 1g | 2163.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(4-hydroxypiperidin-1-yl)acetate (CAS 166955-02-8) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl 2-(4-hydroxypiperidin-1-yl)acetate. InChIKey: PJFODMSLPDZJRR-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl 2-(4-hydroxypiperidin-1-yl)acetate |
| InChIKey | PJFODMSLPDZJRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1CCC(CC1)O |
Computed by PubChem (NCBI)