cas: 1256359-99-5 — see every product listed under this CAS number, including other names
Tert-butyl 5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 98%, 98% (CAS 1256359-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O7U-100mg |
| cas | 1256359-99-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 2003.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1256359-99-5) is a chemical compound with the molecular formula C20H28BNO5 and a molecular weight of 373.3 g/mol. IUPAC name: tert-butyl 5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: IRZPWZYCUJFBJB-UHFFFAOYSA-N.
| Molecular formula | C20H28BNO5 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | tert-butyl 5-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | IRZPWZYCUJFBJB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=C(C=C3)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)