cas: 1050890-47-5 — see every product listed under this CAS number, including other names
Tert-butyl N-{4-aminobicyclo[2.1.1]hexan-1-YL}carbamate, 97%, 97% (CAS 1050890-47-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120QP3-50mg |
| cas | 1050890-47-5 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1005.20 Pln | |
| Chemat | 100mg | 1480.40 Pln | |
| Chemat | 250mg | 2896.40 Pln | |
| Chemat | 1g | 7149.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-amino-1-bicyclo[2.1.1]hexanyl)carbamate (CAS 1050890-47-5) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-(4-amino-1-bicyclo[2.1.1]hexanyl)carbamate. InChIKey: BNNXJCJQIVVPTF-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-(4-amino-1-bicyclo[2.1.1]hexanyl)carbamate |
| InChIKey | BNNXJCJQIVVPTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CCC(C1)(C2)N |
Computed by PubChem (NCBI)