cas: 168540-07-6 — see every product listed under this CAS number, including other names
Tert-butyl n-[1-(hydroxymethyl)cyclopentyl]carbamate, 98% (CAS 168540-07-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F673847-100MG |
| cas | 168540-07-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 315.53 Pln | |
| Fluorochem | 250mg | 502.97 Pln | |
| Fluorochem | 500mg | 919.49 Pln | |
| Fluorochem | 1g | 1231.88 Pln | |
| Fluorochem | 5g | 4163.14 Pln | |
| Fluorochem | 10g | 8260.65 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[1-(hydroxymethyl)cyclopentyl]carbamate (CAS 168540-07-6) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl N-[1-(hydroxymethyl)cyclopentyl]carbamate. InChIKey: KORMKULLVQEUDG-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl N-[1-(hydroxymethyl)cyclopentyl]carbamate |
| InChIKey | KORMKULLVQEUDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCCC1)CO |
Computed by PubChem (NCBI)