CAS 165538-40-9 appears in our catalog under these names: Terutroban, S18886, Terutroban, 98%, 98%, Terutroban, 99.84%, Terutroban (Standard). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 25 mg, 5 mg.
3-[(6R)-6-[(4-chlorophenyl)sulfonylamino]-2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl]propanoic acid (CAS 165538-40-9) is a chemical compound with the molecular formula C20H22ClNO4S and a molecular weight of 407.9 g/mol. IUPAC name: 3-[(6R)-6-[(4-chlorophenyl)sulfonylamino]-2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl]propanoic acid. InChIKey: HWEOXFSBSQIWSY-MRXNPFEDSA-N.
| Molecular formula | C20H22ClNO4S |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | 3-[(6R)-6-[(4-chlorophenyl)sulfonylamino]-2-methyl-5,6,7,8-tetrahydronaphthalen-1-yl]propanoic acid |
| InChIKey | HWEOXFSBSQIWSY-MRXNPFEDSA-N |
| SMILES | CC1=C(C2=C(C[C@@H](CC2)NS(=O)(=O)C3=CC=C(C=C3)Cl)C=C1)CCC(=O)O |
Computed by PubChem (NCBI)