CAS 4766-57-8 appears in our catalog under these names: Tetrabutyl Orthosilicate, Tetra-n-butoxysilane, 97% , Tetrabutyl Orthosilicate, >98.0%(GC), Tetrabutyl orthosilicate 95%, Silicic acid (H4SiO4), tetrabutyl ester, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100ml, 500ml, 25g, 100g, 25ml, 5g, 500g.
Tetrabutyl silicate (CAS 4766-57-8) is a chemical compound with the molecular formula C16H36O4Si and a molecular weight of 320.54 g/mol. IUPAC name: tetrabutyl silicate. InChIKey: UQMOLLPKNHFRAC-UHFFFAOYSA-N.
| Molecular formula | C16H36O4Si |
|---|---|
| Molecular weight | 320.54 g/mol |
| IUPAC name | tetrabutyl silicate |
| InChIKey | UQMOLLPKNHFRAC-UHFFFAOYSA-N |
| SMILES | CCCCO[Si](OCCCC)(OCCCC)OCCCC |
Computed by PubChem (NCBI)