CAS 4368-51-8 appears in our catalog under these names: Tetraheptylammonium Bromide, >95% (HPLC), Tetraheptylammonium bromide, Tetra-n-heptylammonium bromide, 99% , Tetraheptylammonium bromide, Tetraheptylammonium Bromide, >98.0%(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 50g, 250g, 500g.
Tetraheptylazanium bromide (CAS 4368-51-8) is a chemical compound with the molecular formula C28H60BrN and a molecular weight of 490.7 g/mol. IUPAC name: tetraheptylazanium bromide. InChIKey: YQIVQBMEBZGFBY-UHFFFAOYSA-M.
| Molecular formula | C28H60BrN |
|---|---|
| Molecular weight | 490.7 g/mol |
| IUPAC name | tetraheptylazanium bromide |
| InChIKey | YQIVQBMEBZGFBY-UHFFFAOYSA-M |
| SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Br-] |
Computed by PubChem (NCBI)